C24H25ClN2O4S — CID 66552394
(3R,3aS,6aS)-1-[(2-chlorophenyl)methyl]-5-cyclohexyl-3-hydroxy-6a-methyl-3-thiophen-2-yl-3aH-pyrrolo[3,4-b]pyrrole-2,4,6-trione (PubChem CID 66552394) has the molecular formula C24H25ClN2O4S and a molecular weight of 472.99 g/mol. Its IUPAC name is (3R,3aS,6aS)-1-[(2-chlorophenyl)methyl]-5-cyclohexyl-3-hydroxy-6a-methyl-3-thiophen-2-yl-3aH-pyrrolo[3,4-b]pyrrole-2,4,6-trione.
| Compound Name | (3R,3aS,6aS)-1-[(2-chlorophenyl)methyl]-5-cyclohexyl-3-hydroxy-6a-methyl-3-thiophen-2-yl-3aH-pyrrolo[3,4-b]pyrrole-2,4,6-trione |
|---|---|
| PubChem CID | 66552394 |
| Molecular Formula | C24H25ClN2O4S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (3R,3aS,6aS)-1-[(2-chlorophenyl)methyl]-5-cyclohexyl-3-hydroxy-6a-methyl-3-thiophen-2-yl-3aH-pyrrolo[3,4-b]pyrrole-2,4,6-trione |
| SMILES | C[C@@]12C(=O)N(C3CCCCC3)C(=O)[C@@H]1[C@](O)(c1cccs1)C(=O)N2Cc1ccccc1Cl |
| InChI | InChI=1S/C24H25ClN2O4S/c1-23-19(20(28)27(21(23)29)16-9-3-2-4-10-16)24(31,18-12-7-13-32-18)22(30)26(23)14-15-8-5-6-11-17(15)25/h5-8,11-13,16,19,31H,2-4,9-10,14H2,1H3/t19-,23-,24+/m0/s1 |
| InChIKey | SFSSGZOIASOJDT-WDJPJFJCSA-N |
| XLogP | 3.71 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|