C22H24O — CID 102565642
(4S,5R)-4-benzyl-5-methyl-2-phenyl-5-(trideuteriomethyl)-3-oxatricyclo[4.2.0.02,4]octane (PubChem CID 102565642) has the molecular formula C22H24O and a molecular weight of 307.45 g/mol. Its IUPAC name is (4S,5R)-4-benzyl-5-methyl-2-phenyl-5-(trideuteriomethyl)-3-oxatricyclo[4.2.0.02,4]octane.
| Compound Name | (4S,5R)-4-benzyl-5-methyl-2-phenyl-5-(trideuteriomethyl)-3-oxatricyclo[4.2.0.02,4]octane |
|---|---|
| PubChem CID | 102565642 |
| Molecular Formula | C22H24O |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (4S,5R)-4-benzyl-5-methyl-2-phenyl-5-(trideuteriomethyl)-3-oxatricyclo[4.2.0.02,4]octane |
| SMILES | [2H]C([2H])([2H])[C@]1(C)C2CCC2C2(c3ccccc3)O[C@]21Cc1ccccc1 |
| InChI | InChI=1S/C22H24O/c1-20(2)18-13-14-19(18)22(17-11-7-4-8-12-17)21(20,23-22)15-16-9-5-3-6-10-16/h3-12,18-19H,13-15H2,1-2H3/t18?,19?,21-,22?/m0/s1/i1D3/t18?,19?,20-,21-,22? |
| InChIKey | VYVHUHVDCLKXML-HUHGOEDKSA-N |
| XLogP | 4.96 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|