C17H22 — CID 124835319
(1R,2S,3R,4S,5S)-3-ethyl-2,3-dimethyl-4-phenyltricyclo[3.2.0.02,4]heptane (PubChem CID 124835319) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (1R,2S,3R,4S,5S)-3-ethyl-2,3-dimethyl-4-phenyltricyclo[3.2.0.02,4]heptane.
| Compound Name | (1R,2S,3R,4S,5S)-3-ethyl-2,3-dimethyl-4-phenyltricyclo[3.2.0.02,4]heptane |
|---|---|
| PubChem CID | 124835319 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (1R,2S,3R,4S,5S)-3-ethyl-2,3-dimethyl-4-phenyltricyclo[3.2.0.02,4]heptane |
| SMILES | CC[C@]1(C)[C@]2(C)[C@@H]3CC[C@@H]3[C@]12c1ccccc1 |
| InChI | InChI=1S/C17H22/c1-4-15(2)16(3)13-10-11-14(13)17(15,16)12-8-6-5-7-9-12/h5-9,13-14H,4,10-11H2,1-3H3/t13-,14+,15-,16+,17-/m1/s1 |
| InChIKey | PTZXKJVXMGQINX-BPKGMFCQSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |