C20H22N2 — CID 10708640
(1S,4R,5S,6S)-5,6-dimethyl-1,4-diphenyl-2,3-diazabicyclo[2.2.2]oct-2-ene (PubChem CID 10708640) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (1S,4R,5S,6S)-5,6-dimethyl-1,4-diphenyl-2,3-diazabicyclo[2.2.2]oct-2-ene.
| Compound Name | (1S,4R,5S,6S)-5,6-dimethyl-1,4-diphenyl-2,3-diazabicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 10708640 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (1S,4R,5S,6S)-5,6-dimethyl-1,4-diphenyl-2,3-diazabicyclo[2.2.2]oct-2-ene |
| SMILES | C[C@H]1[C@H](C)[C@]2(c3ccccc3)CC[C@@]1(c1ccccc1)N=N2 |
| InChI | InChI=1S/C20H22N2/c1-15-16(2)20(18-11-7-4-8-12-18)14-13-19(15,21-22-20)17-9-5-3-6-10-17/h3-12,15-16H,13-14H2,1-2H3/t15-,16-,19-,20+/m0/s1 |
| InChIKey | JUMSHGPYVVJQAP-CPLUKWAASA-N |
| XLogP | 5.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |