C21H20N2 — CID 98554631
(1S,2R,5S,6S,7S,9S)-1,6-diphenyl-10,11-diazatetracyclo[4.3.2.02,5.07,9]undec-10-ene (PubChem CID 98554631) has the molecular formula C21H20N2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1S,2R,5S,6S,7S,9S)-1,6-diphenyl-10,11-diazatetracyclo[4.3.2.02,5.07,9]undec-10-ene.
| Compound Name | (1S,2R,5S,6S,7S,9S)-1,6-diphenyl-10,11-diazatetracyclo[4.3.2.02,5.07,9]undec-10-ene |
|---|---|
| PubChem CID | 98554631 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (1S,2R,5S,6S,7S,9S)-1,6-diphenyl-10,11-diazatetracyclo[4.3.2.02,5.07,9]undec-10-ene |
| SMILES | c1ccc([C@]23N=N[C@@](c4ccccc4)([C@@H]4CC[C@@H]42)[C@H]2C[C@@H]23)cc1 |
| InChI | InChI=1S/C21H20N2/c1-3-7-14(8-4-1)20-16-11-12-17(16)21(23-22-20,19-13-18(19)20)15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | FWXPESVBGZKFCH-STHVQZNPSA-N |
| XLogP | 4.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |