C13H9N — CID 15701219
tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-2-carbonitrile (PubChem CID 15701219) has the molecular formula C13H9N and a molecular weight of 179.22 g/mol. Its IUPAC name is tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-2-carbonitrile.
| Compound Name | tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-2-carbonitrile |
|---|---|
| PubChem CID | 15701219 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-2-carbonitrile |
| SMILES | N#CC12c3ccccc3C3C=CC1C32 |
| InChI | InChI=1S/C13H9N/c14-7-13-10-4-2-1-3-8(10)9-5-6-11(13)12(9)13/h1-6,9,11-12H |
| InChIKey | PGDKSHLERHQMBP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|