C21H17NO2 — CID 10543356
(1R,14R)-18,19-dihydroxypentacyclo[12.6.0.02,7.08,13.015,20]icosa-2,4,6,8,10,12,16-heptaene-1-carbonitrile (PubChem CID 10543356) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is (1R,14R)-18,19-dihydroxypentacyclo[12.6.0.02,7.08,13.015,20]icosa-2,4,6,8,10,12,16-heptaene-1-carbonitrile.
| Compound Name | (1R,14R)-18,19-dihydroxypentacyclo[12.6.0.02,7.08,13.015,20]icosa-2,4,6,8,10,12,16-heptaene-1-carbonitrile |
|---|---|
| PubChem CID | 10543356 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (1R,14R)-18,19-dihydroxypentacyclo[12.6.0.02,7.08,13.015,20]icosa-2,4,6,8,10,12,16-heptaene-1-carbonitrile |
| SMILES | N#C[C@]12c3ccccc3-c3ccccc3[C@H]1C1C=CC(O)C(O)C12 |
| InChI | InChI=1S/C21H17NO2/c22-11-21-16-8-4-3-6-13(16)12-5-1-2-7-14(12)18(21)15-9-10-17(23)20(24)19(15)21/h1-10,15,17-20,23-24H/t15?,17?,18-,19?,20?,21-/m0/s1 |
| InChIKey | RUHSNZKEMRITJR-DJGDVFNHSA-N |
| XLogP | 2.75 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|