C20H12N4 — CID 94037159
(1S,4R,7S,10R)-6-phenyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile (PubChem CID 94037159) has the molecular formula C20H12N4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (1S,4R,7S,10R)-6-phenyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1S,4R,7S,10R)-6-phenyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 94037159 |
| Molecular Formula | C20H12N4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (1S,4R,7S,10R)-6-phenyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2C=C[C@@H]3C(c4ccccc4)=C[C@@H]([C@H]32)C1(C#N)C#N |
| InChI | InChI=1S/C20H12N4/c21-9-19(10-22)16-7-6-14-15(13-4-2-1-3-5-13)8-17(18(14)16)20(19,11-23)12-24/h1-8,14,16-18H/t14-,16+,17+,18-/m1/s1 |
| InChIKey | NZLAZQYFEXGYBX-LAVFITLUSA-N |
| XLogP | 3.20 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|