C15H10N4 — CID 124909977
(1R,4R,7R,10R)-5-methyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile (PubChem CID 124909977) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is (1R,4R,7R,10R)-5-methyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1R,4R,7R,10R)-5-methyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 124909977 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1R,4R,7R,10R)-5-methyltricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
| SMILES | CC1=C[C@@H]2C=C[C@@H]3[C@@H]2[C@H]1C(C#N)(C#N)C3(C#N)C#N |
| InChI | InChI=1S/C15H10N4/c1-9-4-10-2-3-11-12(10)13(9)15(7-18,8-19)14(11,5-16)6-17/h2-4,10-13H,1H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | UQDCLDXBLHRLJM-LOWDOPEQSA-N |
| XLogP | 2.06 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|