C17H18N2O — CID 7285419
(2R,5S,6R)-2-methoxy-5,6-dimethyl-6-phenylcyclohex-3-ene-1,1-dicarbonitrile (PubChem CID 7285419) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (2R,5S,6R)-2-methoxy-5,6-dimethyl-6-phenylcyclohex-3-ene-1,1-dicarbonitrile.
| Compound Name | (2R,5S,6R)-2-methoxy-5,6-dimethyl-6-phenylcyclohex-3-ene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 7285419 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R,5S,6R)-2-methoxy-5,6-dimethyl-6-phenylcyclohex-3-ene-1,1-dicarbonitrile |
| SMILES | CO[C@@H]1C=C[C@H](C)[C@](C)(c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C17H18N2O/c1-13-9-10-15(20-3)17(11-18,12-19)16(13,2)14-7-5-4-6-8-14/h4-10,13,15H,1-3H3/t13-,15+,16+/m0/s1 |
| InChIKey | HSQRNZAXHVEEGQ-NUEKZKHPSA-N |
| XLogP | 3.20 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|