C12H13NO2 — CID 10262295
2,5-dimethyl-4-phenyl-1,3-dioxolane-4-carbonitrile (PubChem CID 10262295) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenyl-1,3-dioxolane-4-carbonitrile.
| Compound Name | 2,5-dimethyl-4-phenyl-1,3-dioxolane-4-carbonitrile |
|---|---|
| PubChem CID | 10262295 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2,5-dimethyl-4-phenyl-1,3-dioxolane-4-carbonitrile |
| SMILES | CC1OC(C)C(C#N)(c2ccccc2)O1 |
| InChI | InChI=1S/C12H13NO2/c1-9-12(8-13,15-10(2)14-9)11-6-4-3-5-7-11/h3-7,9-10H,1-2H3 |
| InChIKey | BMGSQBDHEKJJNE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |