About 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile
2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile (PubChem CID 15877012) has the molecular formula C31H28N2
and a molecular weight of 428.58 g/mol. Its IUPAC name is 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile.
Molecular Properties
| Compound Name | 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile |
| PubChem CID | 15877012 |
| Molecular Formula | C31H28N2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile |
| SMILES | Cc1ccc(C2NC(c3ccc(C)cc3)C(C#N)(c3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N2/c1-22-13-17-25(18-14-22)29-28(24-9-5-3-6-10-24)31(21-32,27-11-7-4-8-12-27)30(33-29)26-19-15-23(2)16-20-26/h3-20,28-30,33H,1-2H3 |
| InChIKey | ZPCYGBNNAMIJMI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile?
The IUPAC name of 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile (CID 15877012) is 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile.
What is the SMILES notation for 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile?
The canonical SMILES for 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile is Cc1ccc(C2NC(c3ccc(C)cc3)C(C#N)(c3ccccc3)C2c2ccccc2)cc1.
What is the InChIKey of 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile?
The InChIKey is ZPCYGBNNAMIJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28N2/c1-22-13-17-25(18-14-22)29-28(24-9-5-3-6-10-24)31(21-32,27-11-7-4-8-12-27)30(33-29)26-19-15-23(2)16-20-26/h3-20,28-30,33H,1-2H3.
What are the key properties of 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile?
2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile has a molecular weight of 428.58 g/mol, XLogP of 6.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-methylphenyl)-3,4-diphenylpyrrolidine-3-carbonitrile is sourced from PubChem (CID 15877012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).