C22H22O — CID 124525362
(1S,2R,5R,6S,8R)-7,7-dimethyl-6,8-diphenyltricyclo[3.3.0.02,8]octan-3-one (PubChem CID 124525362) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is (1S,2R,5R,6S,8R)-7,7-dimethyl-6,8-diphenyltricyclo[3.3.0.02,8]octan-3-one.
| Compound Name | (1S,2R,5R,6S,8R)-7,7-dimethyl-6,8-diphenyltricyclo[3.3.0.02,8]octan-3-one |
|---|---|
| PubChem CID | 124525362 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1S,2R,5R,6S,8R)-7,7-dimethyl-6,8-diphenyltricyclo[3.3.0.02,8]octan-3-one |
| SMILES | CC1(C)[C@H](c2ccccc2)[C@@H]2CC(=O)[C@@H]3[C@H]2[C@@]31c1ccccc1 |
| InChI | InChI=1S/C22H22O/c1-21(2)18(14-9-5-3-6-10-14)16-13-17(23)20-19(16)22(20,21)15-11-7-4-8-12-15/h3-12,16,18-20H,13H2,1-2H3/t16-,18+,19-,20+,22-/m0/s1 |
| InChIKey | YLKRVPJZJNTGFN-HXUPBZAASA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |