C20H18O3 — CID 98509801
(1R,2R,6R,7S)-10,10-diphenyl-3,4-dioxatricyclo[5.2.1.02,6]decan-5-one (PubChem CID 98509801) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1R,2R,6R,7S)-10,10-diphenyl-3,4-dioxatricyclo[5.2.1.02,6]decan-5-one.
| Compound Name | (1R,2R,6R,7S)-10,10-diphenyl-3,4-dioxatricyclo[5.2.1.02,6]decan-5-one |
|---|---|
| PubChem CID | 98509801 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (1R,2R,6R,7S)-10,10-diphenyl-3,4-dioxatricyclo[5.2.1.02,6]decan-5-one |
| SMILES | O=C1OO[C@H]2[C@H]1[C@@H]1CC[C@@H]2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O3/c21-19-17-15-11-12-16(18(17)22-23-19)20(15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-18H,11-12H2/t15-,16-,17+,18+/m0/s1 |
| InChIKey | GBVPUFCBQNKZNW-WNRNVDISSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|