C11H12MgO — CID 134998960
magnesium [(1S,2R)-2-methyl-1-phenylcyclopropyl]methanolate (PubChem CID 134998960) has the molecular formula C11H12MgO and a molecular weight of 184.52 g/mol. Its IUPAC name is magnesium [(1S,2R)-2-methyl-1-phenylcyclopropyl]methanolate.
| Compound Name | magnesium [(1S,2R)-2-methyl-1-phenylcyclopropyl]methanolate |
|---|---|
| PubChem CID | 134998960 |
| Molecular Formula | C11H12MgO |
| Molecular Weight | 184.52 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | magnesium [(1S,2R)-2-methyl-1-phenylcyclopropyl]methanolate |
| SMILES | C[C@@H]1[CH-][C@@]1(C[O-])c1ccccc1.[Mg+2] |
| InChI | InChI=1S/C11H12O.Mg/c1-9-7-11(9,8-12)10-5-3-2-4-6-10;/h2-7,9H,8H2,1H3;/q-2;+2/t9-,11+;/m1./s1 |
| InChIKey | HHMFCRITOHFRCL-XQKZEKTMSA-N |
| XLogP | 0.76 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|