About zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene
zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene (PubChem CID 134861633) has the molecular formula C14H20Zn
and a molecular weight of 253.70 g/mol. Its IUPAC name is zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene.
Molecular Properties
| Compound Name | zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene |
| PubChem CID | 134861633 |
| Molecular Formula | C14H20Zn |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene |
| SMILES | CC[C@@H]1[CH-][C@@]1(C)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C12H15.C2H5.Zn/c1-3-10-9-12(10,2)11-7-5-4-6-8-11;1-2;/h4-10H,3H2,1-2H3;1H2,2H3;/q2*-1;+2/t10-,12-;;/m1../s1 |
| InChIKey | LADVTDIUIMHYJX-YNSCCRKDSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene?
The IUPAC name of zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene (CID 134861633) is zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene.
What is the SMILES notation for zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene?
The canonical SMILES for zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene is CC[C@@H]1[CH-][C@@]1(C)c1ccccc1.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene?
The InChIKey is LADVTDIUIMHYJX-YNSCCRKDSA-N. The full InChI is InChI=1S/C12H15.C2H5.Zn/c1-3-10-9-12(10,2)11-7-5-4-6-8-11;1-2;/h4-10H,3H2,1-2H3;1H2,2H3;/q2*-1;+2/t10-,12-;;/m1../s1.
What are the key properties of zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene?
zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene has a molecular weight of 253.70 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene is sourced from PubChem (CID 134861633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).