C14H20Zn — CID 134861633
zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene (PubChem CID 134861633) has the molecular formula C14H20Zn and a molecular weight of 253.70 g/mol. Its IUPAC name is zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene.
| Compound Name | zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene |
|---|---|
| PubChem CID | 134861633 |
| Molecular Formula | C14H20Zn |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | zinc;ethane;[(1R,2S)-2-ethyl-1-methylcyclopropyl]benzene |
| SMILES | CC[C@@H]1[CH-][C@@]1(C)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C12H15.C2H5.Zn/c1-3-10-9-12(10,2)11-7-5-4-6-8-11;1-2;/h4-10H,3H2,1-2H3;1H2,2H3;/q2*-1;+2/t10-,12-;;/m1../s1 |
| InChIKey | LADVTDIUIMHYJX-YNSCCRKDSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|