About 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol
4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol (PubChem CID 141227449) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol.
Molecular Properties
| Compound Name | 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol |
| PubChem CID | 141227449 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol |
| SMILES | CCC12CC(O)C(c3ccccc3)(C(O)C1)C(O)C2 |
| InChI | InChI=1S/C16H22O3/c1-2-15-8-12(17)16(13(18)9-15,14(19)10-15)11-6-4-3-5-7-11/h3-7,12-14,17-19H,2,8-10H2,1H3 |
| InChIKey | RNODMRQHACBPKR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol?
The IUPAC name of 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol (CID 141227449) is 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol.
What is the SMILES notation for 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol?
The canonical SMILES for 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol is CCC12CC(O)C(c3ccccc3)(C(O)C1)C(O)C2.
What is the InChIKey of 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol?
The InChIKey is RNODMRQHACBPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-2-15-8-12(17)16(13(18)9-15,14(19)10-15)11-6-4-3-5-7-11/h3-7,12-14,17-19H,2,8-10H2,1H3.
What are the key properties of 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol?
4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol has a molecular weight of 262.35 g/mol, XLogP of 1.60, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-phenylbicyclo[2.2.2]octane-2,6,7-triol is sourced from PubChem (CID 141227449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).