C7H9Br — CID 131208160
cis-(1S,3S)-2-bromo-1-ethynyl-1,3-dimethylcyclopropane (PubChem CID 131208160) has the molecular formula C7H9Br and a molecular weight of 173.05 g/mol. Its IUPAC name is cis-(1S,3S)-2-bromo-1-ethynyl-1,3-dimethylcyclopropane.
| Compound Name | cis-(1S,3S)-2-bromo-1-ethynyl-1,3-dimethylcyclopropane |
|---|---|
| PubChem CID | 131208160 |
| Molecular Formula | C7H9Br |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | cis-(1S,3S)-2-bromo-1-ethynyl-1,3-dimethylcyclopropane |
| SMILES | C#C[C@@]1(C)C(Br)[C@H]1C |
| InChI | InChI=1S/C7H9Br/c1-4-7(3)5(2)6(7)8/h1,5-6H,2-3H3/t5-,6?,7-/m1/s1 |
| InChIKey | MHNGKIUSPWLXBI-YFBHCESUSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|