C22H44 — CID 158781984
1,1,2,3,4,5-hexamethylcyclopentane (PubChem CID 158781984) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is 1,1,2,3,4,5-hexamethylcyclopentane.
| Compound Name | 1,1,2,3,4,5-hexamethylcyclopentane |
|---|---|
| PubChem CID | 158781984 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | 1,1,2,3,4,5-hexamethylcyclopentane |
| SMILES | CC1C(C)C(C)C(C)(C)C1C.CC1C(C)C(C)C(C)(C)C1C |
| InChI | InChI=1S/2C11H22/c2*1-7-8(2)10(4)11(5,6)9(7)3/h2*7-10H,1-6H3 |
| InChIKey | IRERYSFVTSTNHK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |