C34H62V — CID 162022840
1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-heptadecamethyl-2,3,4,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene;vanadium (PubChem CID 162022840) has the molecular formula C34H62V and a molecular weight of 521.81 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-heptadecamethyl-2,3,4,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene;vanadium.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-heptadecamethyl-2,3,4,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene;vanadium |
|---|---|
| PubChem CID | 162022840 |
| Molecular Formula | C34H62V |
| Molecular Weight | 521.81 g/mol |
| Exact Mass | 521.43 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-heptadecamethyl-2,3,4,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene;vanadium |
| SMILES | CC1C(C)C(C)C2(C)C(C)(C1C)C(C)C(C)C1(C)C3(C)C(C)C(C)C(C)C3(C)C(C)C(C)C21C.[V] |
| InChI | InChI=1S/C34H62.V/c1-18-19(2)23(6)31(14)29(12,21(18)4)25(8)27(10)34(17)32(15)24(7)20(3)22(5)30(32,13)26(9)28(11)33(31,34)16;/h18-28H,1-17H3; |
| InChIKey | YUYXWVARBWFFHM-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.81 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |