C30H50 — CID 123795452
1,2,3,4,4,5,5,6,7,8,9,10,11,12,13,14-hexadecamethylhexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane (PubChem CID 123795452) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6,7,8,9,10,11,12,13,14-hexadecamethylhexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane.
| Compound Name | 1,2,3,4,4,5,5,6,7,8,9,10,11,12,13,14-hexadecamethylhexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane |
|---|---|
| PubChem CID | 123795452 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 1,2,3,4,4,5,5,6,7,8,9,10,11,12,13,14-hexadecamethylhexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane |
| SMILES | CC1C(C)C2(C)C1(C)C1(C)C2(C)C2(C)C3(C)C4(C)C(C)(C)C(C)(C)C4(C)C3(C)C12C |
| InChI | InChI=1S/C30H50/c1-17-18(2)22(8)21(17,7)25(11)26(22,12)30(16)28(14)24(10)20(5,6)19(3,4)23(24,9)27(28,13)29(25,30)15/h17-18H,1-16H3 |
| InChIKey | BKBKPCVOACUKAK-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|