C37H66 — CID 58944237
1,2,3,4,4,5,5,6,7,8,9,10,10,11,11,12,12,13,14,14,15,15-docosamethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane (PubChem CID 58944237) has the molecular formula C37H66 and a molecular weight of 510.94 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6,7,8,9,10,10,11,11,12,12,13,14,14,15,15-docosamethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane.
| Compound Name | 1,2,3,4,4,5,5,6,7,8,9,10,10,11,11,12,12,13,14,14,15,15-docosamethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane |
|---|---|
| PubChem CID | 58944237 |
| Molecular Formula | C37H66 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.52 |
| IUPAC Name | 1,2,3,4,4,5,5,6,7,8,9,10,10,11,11,12,12,13,14,14,15,15-docosamethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane |
| SMILES | CC1(C)C(C)(C)C2(C)C(C)(C1(C)C)C1(C)C(C)(C)C2(C)C2(C)C3(C)C(C)(C)C(C)(C)C(C)(C3(C)C)C12C |
| InChI | InChI=1S/C37H66/c1-23(2)24(3,4)32(17)33(18,25(23,5)6)35(20)29(13,14)34(32,19)36(21)30(15)26(7,8)27(9,10)31(16,28(30,11)12)37(35,36)22/h1-22H3 |
| InChIKey | NXBRMVCTJDFEHQ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|