C16H25F — CID 69033861
1,2,3,4,5,6,7,8-octamethylcubane;hydrofluoride (PubChem CID 69033861) has the molecular formula C16H25F and a molecular weight of 236.37 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octamethylcubane;hydrofluoride.
| Compound Name | 1,2,3,4,5,6,7,8-octamethylcubane;hydrofluoride |
|---|---|
| PubChem CID | 69033861 |
| Molecular Formula | C16H25F |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octamethylcubane;hydrofluoride |
| SMILES | CC12C3(C)C4(C)C1(C)C1(C)C2(C)C3(C)C41C.F |
| InChI | InChI=1S/C16H24.FH/c1-9-10(2)13(5)11(9,3)15(7)12(9,4)14(10,6)16(13,15)8;/h1-8H3;1H |
| InChIKey | PHEMYRMAHDHLFZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |