C38H66 — CID 123205214
1,2,3,4,4,5,5,6,6,7,8,9,9,10,11,12,13,13,14,14,15,16-docosamethylhexacyclo[8.6.0.02,8.03,7.011,16.012,15]hexadecane (PubChem CID 123205214) has the molecular formula C38H66 and a molecular weight of 522.95 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6,6,7,8,9,9,10,11,12,13,13,14,14,15,16-docosamethylhexacyclo[8.6.0.02,8.03,7.011,16.012,15]hexadecane.
| Compound Name | 1,2,3,4,4,5,5,6,6,7,8,9,9,10,11,12,13,13,14,14,15,16-docosamethylhexacyclo[8.6.0.02,8.03,7.011,16.012,15]hexadecane |
|---|---|
| PubChem CID | 123205214 |
| Molecular Formula | C38H66 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.52 |
| IUPAC Name | 1,2,3,4,4,5,5,6,6,7,8,9,9,10,11,12,13,13,14,14,15,16-docosamethylhexacyclo[8.6.0.02,8.03,7.011,16.012,15]hexadecane |
| SMILES | CC1(C)C(C)(C)C2(C)C(C)(C1(C)C)C1(C)C2(C)C(C)(C)C2(C)C3(C)C4(C)C(C)(C)C(C)(C)C4(C)C3(C)C21C |
| InChI | InChI=1S/C38H66/c1-23(2)24(3,4)29(13)30(14,25(23,5)6)35(19)33(29,17)28(11,12)34(18)36(20)31(15)26(7,8)27(9,10)32(31,16)37(36,21)38(34,35)22/h1-22H3 |
| InChIKey | WTNDYSXYELZGMQ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |