C29H50 — CID 123620916
1,2,3,4,4,5,5,6,7,8,8,9,10,11,11,13-hexadecamethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane (PubChem CID 123620916) has the molecular formula C29H50 and a molecular weight of 398.72 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6,7,8,8,9,10,11,11,13-hexadecamethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane.
| Compound Name | 1,2,3,4,4,5,5,6,7,8,8,9,10,11,11,13-hexadecamethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane |
|---|---|
| PubChem CID | 123620916 |
| Molecular Formula | C29H50 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | 1,2,3,4,4,5,5,6,7,8,8,9,10,11,11,13-hexadecamethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane |
| SMILES | CC1(C)CC2(C)C1(C)C1(C)C(C)(C)C3(C)C4(C)C(C)(C)C(C)(C)C4(C)C3(C)C21C |
| InChI | InChI=1S/C29H50/c1-18(2)17-22(9)23(18,10)26(13)21(7,8)27(14)24(11)19(3,4)20(5,6)25(24,12)29(27,16)28(22,26)15/h17H2,1-16H3 |
| InChIKey | HJEZEBYFWPAALV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |