C20H34 — CID 123585245
1,2,3,3,5,6,7,8,9,10-decamethyltetracyclo[4.4.0.02,5.07,10]decane (PubChem CID 123585245) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1,2,3,3,5,6,7,8,9,10-decamethyltetracyclo[4.4.0.02,5.07,10]decane.
| Compound Name | 1,2,3,3,5,6,7,8,9,10-decamethyltetracyclo[4.4.0.02,5.07,10]decane |
|---|---|
| PubChem CID | 123585245 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1,2,3,3,5,6,7,8,9,10-decamethyltetracyclo[4.4.0.02,5.07,10]decane |
| SMILES | CC1C(C)C2(C)C1(C)C1(C)C3(C)CC(C)(C)C3(C)C21C |
| InChI | InChI=1S/C20H34/c1-12-13(2)17(7)16(12,6)19(9)15(5)11-14(3,4)18(15,8)20(17,19)10/h12-13H,11H2,1-10H3 |
| InChIKey | JSFGLXZWTQUJIN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |