C22H36 — CID 123472690
1,3,4,5,6,8,9,10,11,12-decamethylpentacyclo[5.4.1.03,10.04,12.05,9]dodecane (PubChem CID 123472690) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1,3,4,5,6,8,9,10,11,12-decamethylpentacyclo[5.4.1.03,10.04,12.05,9]dodecane.
| Compound Name | 1,3,4,5,6,8,9,10,11,12-decamethylpentacyclo[5.4.1.03,10.04,12.05,9]dodecane |
|---|---|
| PubChem CID | 123472690 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1,3,4,5,6,8,9,10,11,12-decamethylpentacyclo[5.4.1.03,10.04,12.05,9]dodecane |
| SMILES | CC1C2(C)CC3(C)C1(C)C1(C)C(C)C4C(C)C1(C)C3(C)C42C |
| InChI | InChI=1S/C22H36/c1-12-15-13(2)19(7)18(12,6)20(8)14(3)16(4)11-17(20,5)22(19,10)21(15,16)9/h12-15H,11H2,1-10H3 |
| InChIKey | PZBWEJWYASZVDN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |