C24H32 — CID 143863315
4,5,5,6,7,8,14,15-octamethylnonacyclo[8.6.0.01,12.02,7.02,9.03,6.03,16.04,15.013,16]hexadecane (PubChem CID 143863315) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 4,5,5,6,7,8,14,15-octamethylnonacyclo[8.6.0.01,12.02,7.02,9.03,6.03,16.04,15.013,16]hexadecane.
| Compound Name | 4,5,5,6,7,8,14,15-octamethylnonacyclo[8.6.0.01,12.02,7.02,9.03,6.03,16.04,15.013,16]hexadecane |
|---|---|
| PubChem CID | 143863315 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 4,5,5,6,7,8,14,15-octamethylnonacyclo[8.6.0.01,12.02,7.02,9.03,6.03,16.04,15.013,16]hexadecane |
| SMILES | CC1C2C3CC4C5C(C)C6(C)C7(C)C(C)(C)C8(C)C1(C)C21C34C56C871 |
| InChI | InChI=1S/C24H32/c1-10-14-12-9-13-15-11(2)18(6)20(8)16(3,4)19(7)17(10,5)22(14)21(12,13)23(15,18)24(19,20)22/h10-15H,9H2,1-8H3 |
| InChIKey | XPEZCZJJYQUKKO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |