C26H42 — CID 123841923
1,2,3,4,5,6,12,14,14-nonamethyl-3-propan-2-ylhexacyclo[6.6.0.02,7.04,13.05,11.09,13]tetradecane (PubChem CID 123841923) has the molecular formula C26H42 and a molecular weight of 354.62 g/mol. Its IUPAC name is 1,2,3,4,5,6,12,14,14-nonamethyl-3-propan-2-ylhexacyclo[6.6.0.02,7.04,13.05,11.09,13]tetradecane.
| Compound Name | 1,2,3,4,5,6,12,14,14-nonamethyl-3-propan-2-ylhexacyclo[6.6.0.02,7.04,13.05,11.09,13]tetradecane |
|---|---|
| PubChem CID | 123841923 |
| Molecular Formula | C26H42 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | 1,2,3,4,5,6,12,14,14-nonamethyl-3-propan-2-ylhexacyclo[6.6.0.02,7.04,13.05,11.09,13]tetradecane |
| SMILES | CC1C2C3C4CC5C(C)C46C(C)(C)C3(C)C2(C)C(C)(C(C)C)C6(C)C15C |
| InChI | InChI=1S/C26H42/c1-13(2)22(8)24(10)18-15(4)21(7)16-12-17-19(18)23(24,9)20(5,6)26(17,14(16)3)25(21,22)11/h13-19H,12H2,1-11H3 |
| InChIKey | HBOPAIZOVHNHQW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |