C18H26 — CID 174043765
4,5,6,9,10,11-hexamethylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane (PubChem CID 174043765) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 4,5,6,9,10,11-hexamethylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane.
| Compound Name | 4,5,6,9,10,11-hexamethylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane |
|---|---|
| PubChem CID | 174043765 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4,5,6,9,10,11-hexamethylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane |
| SMILES | CC1C2C3C(C)C4(C)C(C)C5C6C(C)C1(C)C26C354 |
| InChI | InChI=1S/C18H26/c1-7-11-12-9(3)16(6)10(4)14-13-8(2)15(7,5)17(11,13)18(12,14)16/h7-14H,1-6H3 |
| InChIKey | PSHLVPSWOPKKDB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |