About 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane
3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane (PubChem CID 123223555) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane.
Analyze 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane?
The IUPAC name of 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane (CID 123223555) is 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane.
What is the SMILES notation for 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane?
The canonical SMILES for 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane is CCC1(CC)C2C3C(C(C)C21C)C3(C)C.
What is the InChIKey of 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane?
The InChIKey is WVGOKSUUAAPPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26/c1-7-15(8-2)12-11-10(13(11,4)5)9(3)14(12,15)6/h9-12H,7-8H2,1-6H3.
What are the key properties of 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane?
3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane has a molecular weight of 206.37 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-4,5,7,7-tetramethyltricyclo[4.1.0.02,4]heptane is sourced from PubChem (CID 123223555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).