C11H18 — CID 163529293
(2R,5R)-1,2,3,4,5-pentamethyltricyclo[3.1.0.02,6]hexane (PubChem CID 163529293) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (2R,5R)-1,2,3,4,5-pentamethyltricyclo[3.1.0.02,6]hexane.
| Compound Name | (2R,5R)-1,2,3,4,5-pentamethyltricyclo[3.1.0.02,6]hexane |
|---|---|
| PubChem CID | 163529293 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (2R,5R)-1,2,3,4,5-pentamethyltricyclo[3.1.0.02,6]hexane |
| SMILES | CC1C(C)[C@]2(C)C3C2(C)[C@]13C |
| InChI | InChI=1S/C11H18/c1-6-7(2)10(4)8-9(6,3)11(8,10)5/h6-8H,1-5H3/t6?,7?,8?,9-,10-,11?/m1/s1 |
| InChIKey | DRNMIRLUWXNPHX-DVDISBGFSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |