C13H24 — CID 142061780
1,2,2,3,5,5,6-heptamethylbicyclo[2.1.1]hexane (PubChem CID 142061780) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,2,2,3,5,5,6-heptamethylbicyclo[2.1.1]hexane.
| Compound Name | 1,2,2,3,5,5,6-heptamethylbicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 142061780 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,2,2,3,5,5,6-heptamethylbicyclo[2.1.1]hexane |
| SMILES | CC1C2C(C)C(C)(C1(C)C)C2(C)C |
| InChI | InChI=1S/C13H24/c1-8-10-9(2)13(7,11(8,3)4)12(10,5)6/h8-10H,1-7H3 |
| InChIKey | OBVRCSZPBBZUQR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |