About 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane
4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane (PubChem CID 123295375) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane.
Analyze 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane?
The IUPAC name of 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane (CID 123295375) is 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane.
What is the SMILES notation for 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane?
The canonical SMILES for 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane is CC1CC2(C)C3C4C(C)C2(C)C143.
What is the InChIKey of 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane?
The InChIKey is DBODPQIEASTKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-6-5-10(3)9-8-7(2)11(10,4)12(6,8)9/h6-9H,5H2,1-4H3.
What are the key properties of 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane?
4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane has a molecular weight of 162.28 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,8-tetramethyltetracyclo[3.3.0.01,3.02,6]octane is sourced from PubChem (CID 123295375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).