C14H24 — CID 123913198
2,3,4,5,6,7-hexamethyltricyclo[3.2.1.03,6]octane (PubChem CID 123913198) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexamethyltricyclo[3.2.1.03,6]octane.
| Compound Name | 2,3,4,5,6,7-hexamethyltricyclo[3.2.1.03,6]octane |
|---|---|
| PubChem CID | 123913198 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2,3,4,5,6,7-hexamethyltricyclo[3.2.1.03,6]octane |
| SMILES | CC1C2CC3(C)C(C)C1(C)C3(C)C2C |
| InChI | InChI=1S/C14H24/c1-8-11-7-12(4)10(3)13(8,5)14(12,6)9(11)2/h8-11H,7H2,1-6H3 |
| InChIKey | JPUPJHHWTWVXRZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |