C18H30 — CID 123527402
1,2,3,5,6,7,11-heptamethyltetracyclo[6.2.1.02,5.03,10]undecane (PubChem CID 123527402) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,2,3,5,6,7,11-heptamethyltetracyclo[6.2.1.02,5.03,10]undecane.
| Compound Name | 1,2,3,5,6,7,11-heptamethyltetracyclo[6.2.1.02,5.03,10]undecane |
|---|---|
| PubChem CID | 123527402 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,2,3,5,6,7,11-heptamethyltetracyclo[6.2.1.02,5.03,10]undecane |
| SMILES | CC1C2CC3C4(C)CC(C)(C1C)C4(C)C3(C)C2C |
| InChI | InChI=1S/C18H30/c1-10-11(2)15(4)9-16(5)14-8-13(10)12(3)17(14,6)18(15,16)7/h10-14H,8-9H2,1-7H3 |
| InChIKey | MHGIXKASSCZKOZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |