C40H66 — CID 123250463
12-ethyl-1,3,4,5,6,7,8,9,10,13,14,15,16,17,18,19-hexadecamethyl-6-propan-2-yloctacyclo[9.8.0.03,18.04,17.05,16.07,15.08,14.09,13]nonadecane (PubChem CID 123250463) has the molecular formula C40H66 and a molecular weight of 546.97 g/mol. Its IUPAC name is 12-ethyl-1,3,4,5,6,7,8,9,10,13,14,15,16,17,18,19-hexadecamethyl-6-propan-2-yloctacyclo[9.8.0.03,18.04,17.05,16.07,15.08,14.09,13]nonadecane.
| Compound Name | 12-ethyl-1,3,4,5,6,7,8,9,10,13,14,15,16,17,18,19-hexadecamethyl-6-propan-2-yloctacyclo[9.8.0.03,18.04,17.05,16.07,15.08,14.09,13]nonadecane |
|---|---|
| PubChem CID | 123250463 |
| Molecular Formula | C40H66 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.52 |
| IUPAC Name | 12-ethyl-1,3,4,5,6,7,8,9,10,13,14,15,16,17,18,19-hexadecamethyl-6-propan-2-yloctacyclo[9.8.0.03,18.04,17.05,16.07,15.08,14.09,13]nonadecane |
| SMILES | CCC1C2C(C)C3(C)C1(C)C1(C)C3(C)C3(C)C(C)(C(C)C)C4(C)C5(C)C6(C)CC2(C)C(C)C6(C)C5(C)C4(C)C13C |
| InChI | InChI=1S/C40H66/c1-20-25-26-23(4)30(9)32(25,11)38(17)36(30,15)35(14)29(8,22(2)3)34(13)33(12)28(7)21-27(26,6)24(5)31(28,10)37(33,16)39(34,18)40(35,38)19/h22-26H,20-21H2,1-19H3 |
| InChIKey | WDDPVIHCSHONGN-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |