C7H12O2 — CID 131851587
2,2-dimethyl-4,7-dioxaspiro[2.4]heptane (PubChem CID 131851587) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2,2-dimethyl-4,7-dioxaspiro[2.4]heptane.
| Compound Name | 2,2-dimethyl-4,7-dioxaspiro[2.4]heptane |
|---|---|
| PubChem CID | 131851587 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2,2-dimethyl-4,7-dioxaspiro[2.4]heptane |
| SMILES | CC1(C)CC12OCCO2 |
| InChI | InChI=1S/C7H12O2/c1-6(2)5-7(6)8-3-4-9-7/h3-5H2,1-2H3 |
| InChIKey | HMXDLVKPJUUDMO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |