C11H16O4 — CID 91493617
6,6-dimethyl-1,4-dioxaspiro[4.6]undecane-9,10-dione (PubChem CID 91493617) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 6,6-dimethyl-1,4-dioxaspiro[4.6]undecane-9,10-dione.
| Compound Name | 6,6-dimethyl-1,4-dioxaspiro[4.6]undecane-9,10-dione |
|---|---|
| PubChem CID | 91493617 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 6,6-dimethyl-1,4-dioxaspiro[4.6]undecane-9,10-dione |
| SMILES | CC1(C)CCC(=O)C(=O)CC12OCCO2 |
| InChI | InChI=1S/C11H16O4/c1-10(2)4-3-8(12)9(13)7-11(10)14-5-6-15-11/h3-7H2,1-2H3 |
| InChIKey | JSZRLBDRMJRFOI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|