C32H60 — CID 158302871
(7Z)-1,2,2,3,3,4,4,5,5,6,7,8,9,9,10,10,11,11,12,12-icosamethylbicyclo[4.3.3]dodec-7-ene (PubChem CID 158302871) has the molecular formula C32H60 and a molecular weight of 444.83 g/mol. Its IUPAC name is (7Z)-1,2,2,3,3,4,4,5,5,6,7,8,9,9,10,10,11,11,12,12-icosamethylbicyclo[4.3.3]dodec-7-ene.
| Compound Name | (7Z)-1,2,2,3,3,4,4,5,5,6,7,8,9,9,10,10,11,11,12,12-icosamethylbicyclo[4.3.3]dodec-7-ene |
|---|---|
| PubChem CID | 158302871 |
| Molecular Formula | C32H60 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.47 |
| IUPAC Name | (7Z)-1,2,2,3,3,4,4,5,5,6,7,8,9,9,10,10,11,11,12,12-icosamethylbicyclo[4.3.3]dodec-7-ene |
| SMILES | C/C1=C(\C)C2(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C1(C)C)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C32H60/c1-21-22(2)31(19)27(11,12)24(5,6)25(7,8)29(15,16)32(20,23(21,3)4)30(17,18)26(9,10)28(31,13)14/h1-20H3/b22-21- |
| InChIKey | AXXMVDRRWJXDTR-DQRAZIAOSA-N |
| XLogP | 10.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|