C24H42 — CID 58944228
1,2,3,4,4,5,6,7,8,8,9,9,10,10-tetradecamethylbicyclo[3.3.2]deca-2,6-diene (PubChem CID 58944228) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1,2,3,4,4,5,6,7,8,8,9,9,10,10-tetradecamethylbicyclo[3.3.2]deca-2,6-diene.
| Compound Name | 1,2,3,4,4,5,6,7,8,8,9,9,10,10-tetradecamethylbicyclo[3.3.2]deca-2,6-diene |
|---|---|
| PubChem CID | 58944228 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1,2,3,4,4,5,6,7,8,8,9,9,10,10-tetradecamethylbicyclo[3.3.2]deca-2,6-diene |
| SMILES | CC1=C(C)C2(C)C(C)(C)C(C)=C(C)C(C)(C1(C)C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C24H42/c1-15-17(3)23(13)20(7,8)16(2)18(4)24(14,19(15,5)6)22(11,12)21(23,9)10/h1-14H3 |
| InChIKey | PCIRUJFGIHTDCN-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|