C18H30 — CID 58944182
1,1,2,3,3a,4,5,6,6,6a-decamethylpentalene (PubChem CID 58944182) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,1,2,3,3a,4,5,6,6,6a-decamethylpentalene.
| Compound Name | 1,1,2,3,3a,4,5,6,6,6a-decamethylpentalene |
|---|---|
| PubChem CID | 58944182 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,1,2,3,3a,4,5,6,6,6a-decamethylpentalene |
| SMILES | CC1=C(C)C2(C)C(C)=C(C)C(C)(C)C2(C)C1(C)C |
| InChI | InChI=1S/C18H30/c1-11-13(3)17(9)14(4)12(2)16(7,8)18(17,10)15(11,5)6/h1-10H3 |
| InChIKey | JTSMXXHWMODAJE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|