C23H38 — CID 58944204
1,3,4,4,5,6,7,8,9,10,11,11-dodecamethyltricyclo[5.4.0.03,10]undeca-5,8-diene (PubChem CID 58944204) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is 1,3,4,4,5,6,7,8,9,10,11,11-dodecamethyltricyclo[5.4.0.03,10]undeca-5,8-diene.
| Compound Name | 1,3,4,4,5,6,7,8,9,10,11,11-dodecamethyltricyclo[5.4.0.03,10]undeca-5,8-diene |
|---|---|
| PubChem CID | 58944204 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 1,3,4,4,5,6,7,8,9,10,11,11-dodecamethyltricyclo[5.4.0.03,10]undeca-5,8-diene |
| SMILES | CC1=C(C)C2(C)C(C)=C(C)C3(C)C(C)(C)C2(C)CC3(C)C1(C)C |
| InChI | InChI=1S/C23H38/c1-14-15(2)22(11)16(3)17(4)23(12)19(7,8)21(22,10)13-20(23,9)18(14,5)6/h13H2,1-12H3 |
| InChIKey | AOUMSZNZDUVEHV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|