C20H36 — CID 58944323
1,2,2,3,3,4,4,5,5,6,7,8-dodecamethylbicyclo[4.2.0]oct-7-ene (PubChem CID 58944323) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,7,8-dodecamethylbicyclo[4.2.0]oct-7-ene.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,7,8-dodecamethylbicyclo[4.2.0]oct-7-ene |
|---|---|
| PubChem CID | 58944323 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,7,8-dodecamethylbicyclo[4.2.0]oct-7-ene |
| SMILES | CC1=C(C)C2(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C12C |
| InChI | InChI=1S/C20H36/c1-13-14(2)20(12)18(9,10)16(5,6)15(3,4)17(7,8)19(13,20)11/h1-12H3 |
| InChIKey | XFWNKEQYWUXTEP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|