C24H46 — CID 143197426
1,2,2,3,3,4,4,5,6,6,7,7,8,9,9-pentadecamethylbicyclo[3.3.1]nonane (PubChem CID 143197426) has the molecular formula C24H46 and a molecular weight of 334.63 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,6,6,7,7,8,9,9-pentadecamethylbicyclo[3.3.1]nonane.
| Compound Name | 1,2,2,3,3,4,4,5,6,6,7,7,8,9,9-pentadecamethylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 143197426 |
| Molecular Formula | C24H46 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.36 |
| IUPAC Name | 1,2,2,3,3,4,4,5,6,6,7,7,8,9,9-pentadecamethylbicyclo[3.3.1]nonane |
| SMILES | CC1C(C)(C)C(C)(C)C2(C)C(C)(C)C(C)(C)C(C)(C)C1(C)C2(C)C |
| InChI | InChI=1S/C24H46/c1-16-17(2,3)18(4,5)24(15)21(10,11)19(6,7)20(8,9)23(16,14)22(24,12)13/h16H,1-15H3 |
| InChIKey | UGHKFDVKKIRZIQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |