C13H30OSi2 — CID 123884172
(1,2,2,3,3,4,4,5-octamethylcyclopentyl)-silyloxysilane (PubChem CID 123884172) has the molecular formula C13H30OSi2 and a molecular weight of 258.55 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5-octamethylcyclopentyl)-silyloxysilane.
| Compound Name | (1,2,2,3,3,4,4,5-octamethylcyclopentyl)-silyloxysilane |
|---|---|
| PubChem CID | 123884172 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (1,2,2,3,3,4,4,5-octamethylcyclopentyl)-silyloxysilane |
| SMILES | CC1C(C)(C)C(C)(C)C(C)(C)C1(C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C13H30OSi2/c1-9-10(2,3)11(4,5)12(6,7)13(9,8)16-14-15/h9H,16H2,1-8,15H3 |
| InChIKey | JQOMZZYPTVPXLO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|