C31H48 — CID 145275266
3,4,4,5,6,6,7,8,9,10,10,11,12,12,13,14-hexadecamethyloctacyclo[7.5.1.01,8.02,5.02,7.03,14.011,15.013,15]pentadecane (PubChem CID 145275266) has the molecular formula C31H48 and a molecular weight of 420.73 g/mol. Its IUPAC name is 3,4,4,5,6,6,7,8,9,10,10,11,12,12,13,14-hexadecamethyloctacyclo[7.5.1.01,8.02,5.02,7.03,14.011,15.013,15]pentadecane.
| Compound Name | 3,4,4,5,6,6,7,8,9,10,10,11,12,12,13,14-hexadecamethyloctacyclo[7.5.1.01,8.02,5.02,7.03,14.011,15.013,15]pentadecane |
|---|---|
| PubChem CID | 145275266 |
| Molecular Formula | C31H48 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | 3,4,4,5,6,6,7,8,9,10,10,11,12,12,13,14-hexadecamethyloctacyclo[7.5.1.01,8.02,5.02,7.03,14.011,15.013,15]pentadecane |
| SMILES | CC1(C)C2(C)C(C)(C)C3(C)C4(C)C5(C)C(C)(C)C6(C)C(C)(C)C7(C)C8(C)C1(C)C23C84C675 |
| InChI | InChI=1S/C31H48/c1-17(2)21(9)18(3,4)24(12)28(16)26(14)20(7,8)22(10)19(5,6)25(13)27(15)23(17,11)29(21,24)31(27,28)30(22,25)26/h1-16H3 |
| InChIKey | OTKXIDXJKHFISJ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |