C31H56 — CID 21304301
1,3,4,5,6,7,9,10,11,12,13,16,17,17-tetradecamethyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 21304301) has the molecular formula C31H56 and a molecular weight of 428.79 g/mol. Its IUPAC name is 1,3,4,5,6,7,9,10,11,12,13,16,17,17-tetradecamethyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | 1,3,4,5,6,7,9,10,11,12,13,16,17,17-tetradecamethyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 21304301 |
| Molecular Formula | C31H56 |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 428.44 |
| IUPAC Name | 1,3,4,5,6,7,9,10,11,12,13,16,17,17-tetradecamethyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC1CC(C)C2(C)C(C)(C1C)C(C)C(C)C1C3CC(C)C(C)(C)C3(C)C(C)C(C)C12C |
| InChI | InChI=1S/C31H56/c1-17-15-19(3)31(14)28(11,21(17)5)22(6)20(4)26-25-16-18(2)27(9,10)29(25,12)23(7)24(8)30(26,31)13/h17-26H,15-16H2,1-14H3 |
| InChIKey | CFBWMNMKFFCKMK-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |