C17H28 — CID 163646390
(1R,6S)-6-ethyl-3,5,7,10-tetramethyltetracyclo[4.4.1.01,4.05,8]undecane (PubChem CID 163646390) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (1R,6S)-6-ethyl-3,5,7,10-tetramethyltetracyclo[4.4.1.01,4.05,8]undecane.
| Compound Name | (1R,6S)-6-ethyl-3,5,7,10-tetramethyltetracyclo[4.4.1.01,4.05,8]undecane |
|---|---|
| PubChem CID | 163646390 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (1R,6S)-6-ethyl-3,5,7,10-tetramethyltetracyclo[4.4.1.01,4.05,8]undecane |
| SMILES | CC[C@@]12C[C@@]34CC(C)C3C1(C)C(CC4C)C2C |
| InChI | InChI=1S/C17H28/c1-6-17-9-16-8-10(2)14(16)15(17,5)13(12(17)4)7-11(16)3/h10-14H,6-9H2,1-5H3/t10?,11?,12?,13?,14?,15?,16-,17+/m1/s1 |
| InChIKey | IIONOOFZIWNSMP-VGULIUCWSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |