C13H24 — CID 123592730
1-ethyl-2,3,3,4,5-pentamethylbicyclo[3.1.0]hexane (PubChem CID 123592730) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1-ethyl-2,3,3,4,5-pentamethylbicyclo[3.1.0]hexane.
| Compound Name | 1-ethyl-2,3,3,4,5-pentamethylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 123592730 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1-ethyl-2,3,3,4,5-pentamethylbicyclo[3.1.0]hexane |
| SMILES | CCC12CC1(C)C(C)C(C)(C)C2C |
| InChI | InChI=1S/C13H24/c1-7-13-8-12(13,6)9(2)11(4,5)10(13)3/h9-10H,7-8H2,1-6H3 |
| InChIKey | MPVRFWJLBQLBAH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |